Prucalopride-13C,d3（Cat No.:S000514） is an isotopically labeled version of prucalopride, where one carbon atom is replaced with carbon-13 (13C) and three hydrogen atoms are replaced with deuterium (d3). Prucalopride is a selective serotonin receptor agonist used primarily to treat chronic constipation by enhancing bowel motility. The introduction of isotopic labeling with 13C and deuterium in prucalopride-13C,d3 increases the molecule’s stability and allows for more accurate tracking of its metabolism and pharmacokinetics through advanced analytical techniques. This detailed tracking aids in optimizing dosage regimens and understanding drug interactions, enhancing the treatment’s effectiveness and safety.
| Catalog Number | S000514 |
| CAS Number | 2140306-00-7 |
| Molecular Formula | C1713CH23D3ClN3O3 |
| Purity | 95% |
| IUPAC Name | 4-amino-5-chloro-N-[1-[3-(trideuterio(113C)methoxy)propyl]piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide |
| InChI | InChI=1S/C18H26ClN3O3/c1-24-9-2-6-22-7-3-12(4-8-22)21-18(23)14-11-15(19)16(20)13-5-10-25-17(13)14/h11-12H,2-10,20H2,1H3,(H,21,23)/i1+1D3 |
| InChIKey | ZPMNHBXQOOVQJL-KQORAOOSSA-N |
| SMILES | COCCCN1CCC(CC1)NC(=O)C2=CC(=C(C3=C2OCC3)N)Cl |
