PRX-08066 Maleic acid is a selective 5-HT2B receptor antagonist with IC50 of 3.4 nM, prevents the severity of pulmonary arterial hypertension in the MCT rat model. Phase 2.
| Catalog Number | R061423 |
| CAS Number | 866206-55-5 |
| Molecular Formula | C19H17ClFN5S.C4H4O4 |
| Purity | ≥95% |
| Storage | 3 years-20°Cpowder |
| SMILES | C1CN(CCC1NC2=C3C=C(SC3=NC=N2)Cl)CC4=CC(=C(C=C4)F)C#N.C(=CC(=O)O)C(=O)O |
| Reference | [1] Porvasnik SL, et al. J Pharmacol Exp Ther, 2010, 334(2), 364-372. |
