For research use only. Not for therapeutic Use.
PS-1145(Cat No.:I003539) is a highly specific inhibitor of IKK (IκB kinase), with an IC50 value of 88 nM. By selectively targeting IKK, an enzyme involved in the activation of NF-κB (nuclear factor kappa-light-chain-enhancer of activated B cells), PS-1145 effectively suppresses the NF-κB signaling pathway. This inhibition can modulate inflammatory responses and potentially hinder the progression of diseases associated with aberrant NF-κB activation, such as autoimmune disorders and certain cancers.
CAS Number | 431898-65-6 |
Synonyms | N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)nicotinamide |
Molecular Formula | C₁₇H₁₁ClN₄O |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 43 mg/mL |
Storage | 2-8°C |
IC50 | 88 nM [1] |
IUPAC Name | N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)pyridine-3-carboxamide |
InChI | InChI=1S/C17H11ClN4O/c18-11-6-13-12-3-5-20-9-15(12)21-16(13)14(7-11)22-17(23)10-2-1-4-19-8-10/h1-9,21H,(H,22,23) |
InChIKey | JZRMBDHPALEPDM-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)C(=O)NC2=CC(=CC3=C2NC4=C3C=CN=C4)Cl |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |