For research use only. Not for therapeutic Use.
PS48(CAT: I011730) is a potent and selective sphingosine kinase 1 (SphK1) inhibitor. It inhibits SphK1 activity by binding to its ATP pocket. SphK1 is an enzyme involved in the regulation of cell proliferation, differentiation, migration, and apoptosis. Inhibition of SphK1 has been shown to have therapeutic potential in various diseases, including cancer, inflammation, and fibrosis. PS48 has been studied as a potential therapeutic agent for cancer treatment.
| Catalog Number | I011730 |
| CAS Number | 1180676-32-7 |
| Synonyms | (Z)-5-(4-chlorophenyl)-3-phenylpent-2-enoic acid |
| Molecular Formula | C17H15ClO2 |
| Purity | ≥95% |
| Target | PDK-1 |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Store at +4C |
| IUPAC Name | (Z)-5-(4-chlorophenyl)-3-phenylpent-2-enoic acid |
| InChI | InChI=1S/C17H15ClO2/c18-16-10-7-13(8-11-16)6-9-15(12-17(19)20)14-4-2-1-3-5-14/h1-5,7-8,10-12H,6,9H2,(H,19,20)/b15-12- |
| InChIKey | LLJYFDRQFPQGNY-QINSGFPZSA-N |
| SMILES | C1=CC=C(C=C1)C(=CC(=O)O)CCC2=CC=C(C=C2)Cl |
