For research use only. Not for therapeutic Use.
Psammaplin A(Cat No.:M001032) is a marine metabolite known for its potent inhibitory activity against HDACs (histone deacetylases) and DNA methyltransferases. It specifically targets HDAC1, exhibiting high selectivity with an IC50 value of 0.9nM. Psammaplin A is 360 times more selective for HDAC1 compared to HDAC6 and shows limited potency towards HDAC7 and HDAC8. Additionally, it demonstrates antibacterial effects against Gram-positive bacteria and inhibits DNA synthesis and the activity of DNA gyrase (DNAgyrase). Psammaplin A holds promise as a potential therapeutic agent for various diseases and further research is warranted.
CAS Number | 110659-91-1 |
Molecular Formula | C22H24Br2N4O6S2 |
Purity | ≥95% |
Target | Epigenetics |
Storage | 2-8°C |
IUPAC Name | (2E)-3-(3-bromo-4-hydroxyphenyl)-N-[2-[2-[[(2E)-3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide |
InChI | InChI=1S/C22H24Br2N4O6S2/c23-15-9-13(1-3-19(15)29)11-17(27-33)21(31)25-5-7-35-36-8-6-26-22(32)18(28-34)12-14-2-4-20(30)16(24)10-14/h1-4,9-10,29-30,33-34H,5-8,11-12H2,(H,25,31)(H,26,32)/b27-17+,28-18+ |
InChIKey | LMAFSGDNHVBIHU-XUIWWLCJSA-N |
SMILES | C1=CC(=C(C=C1CC(=NO)C(=O)NCCSSCCNC(=O)C(=NO)CC2=CC(=C(C=C2)O)Br)Br)O |