For research use only. Not for therapeutic Use.
PSB-12054(CAT: I012285) is a chemical compound known as a potent antagonist of the P2X4 receptor. P2X4 receptors are a subtype of purinergic receptors found on the surface of cells, particularly in the nervous system. These receptors are involved in mediating the effects of ATP (adenosine triphosphate) signaling. By acting as an antagonist of the P2X4 receptor, PSB-12054 can inhibit its activity and potentially modulate ATP-mediated signaling pathways.
Catalog Number | I012285 |
CAS Number | 1407632-07-8 |
Synonyms | N-(benzyloxycarbonyl)phenoxazine; N-Cbz-phenoxazine; 10H-Phenoxazine-10-carboxylic acid, phenylmethyl ester |
Molecular Formula | C20H15NO3 |
Purity | ≥95% |
IUPAC Name | benzyl phenoxazine-10-carboxylate |
InChI | InChI=1S/C20H15NO3/c22-20(23-14-15-8-2-1-3-9-15)21-16-10-4-6-12-18(16)24-19-13-7-5-11-17(19)21/h1-13H,14H2 |
InChIKey | KGVCOYMLGBNCDW-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC(=O)N2C3=CC=CC=C3OC4=CC=CC=C42 |