For research use only. Not for therapeutic Use.
PSB-18484 is a Potent Agonists of the Orphan G Protein-Coupled Receptor GPR17 (EC50 = 32.1 nM).
| Catalog Number | I035140 |
| Synonyms | PSB-18484; PSB 18484; PSB18484. |
| Molecular Formula | C12H9FINO4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 3-(2-Carboxyethyl)-4-fluoro-6-iodo-1H-indole-2-carboxylic Acid |
| InChI | InChI=1S/C12H9FINO4/c13-7-3-5(14)4-8-10(7)6(1-2-9(16)17)11(15-8)12(18)19/h3-4,15H,1-2H2,(H,16,17)(H,18,19) |
| InChIKey | DDCPVTXQTABQGM-UHFFFAOYSA-N |
| SMILES | O=C(C(N1)=C(CCC(O)=O)C2=C1C=C(I)C=C2F)O |
| Reference | 1: Baqi Y, Pillaiyar T, Abdelrahman A, Kaufmann O, Alshaibani S, Rafehi M, |
