For research use only. Not for therapeutic Use.
PSB1114 (Cat No.:I0088999) is a potent and selective agonist of the P2Y2 receptor, a subtype of purinergic receptors involved in cellular signaling. PSB1114 has a low concentration required for half-maximal activation (EC50) of approximately 0.134 μM. It exhibits significant selectivity for the P2Y2 receptor, with over 60-fold selectivity compared to P2Y4 and P2Y6 receptors. The activation of P2Y2 receptors by PSB1114 can modulate various cellular responses and signaling pathways associated with purinergic signaling, making it a valuable tool in pharmacological and biological research.
| Catalog Number | I008899 |
| CAS Number | 1657025-60-9 |
| Synonyms | PSB1114; PSB 1114; PSB-1114.;({[({[(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-oxo-4-sulfanylidene-1,2,3,4-tetrahydropyrimidin-1-yl)oxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}difluoromethyl)phosphonic acid |
| Molecular Formula | C10H11F2N2Na4O13P3S |
| Purity | ≥95% |
| Target | P2Y Receptor |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | [[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
| InChI | InChI=1S/C10H15F2N2O13P3S/c11-10(12,28(18,19)20)29(21,22)27-30(23,24)25-3-4-6(15)7(16)8(26-4)14-2-1-5(31)13-9(14)17/h1-2,4,6-8,15-16H,3H2,(H,21,22)(H,23,24)(H,13,17,31)(H2,18,19,20)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | DFGBPSGNGNHNQM-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)NC1=S)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(C(F)(F)P(=O)(O)O)O)O)O |
| Reference | <br /> |
