For research use only. Not for therapeutic Use.
Pseudohypericin (Cat.No:R072689) is a naturally occurring compound found in St. John’s Wort (Hypericum perforatum). It shares structural similarities with hypericin and exhibits potential antiviral and antitumor activities. Pseudohypericin’s complex photodynamic properties make it an interesting subject of research in phototherapy and its potential applications in various medical fields.
| Catalog Number | R072689 |
| CAS Number | 55954-61-5 |
| Molecular Formula | C30H16O9 |
| Purity | ≥95% |
| InChI | InChI=1S/C30H16O9/c1-7-2-9(32)19-23-15(7)16-8(6-31)3-10(33)20-24(16)28-26-18(12(35)5-14(37)22(26)30(20)39)17-11(34)4-13(36)21(29(19)38)25(17)27(23)28/h2-5,31-37H,6H2,1H3 |
| InChIKey | YXBUQQDFTYOHQI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C3=C1C4=C5C(=C(C=C4CO)O)C(=O)C6=C(C=C(C7=C6C5=C3C8=C7C(=CC(=C8C2=O)O)O)O)O)O |
