For research use only. Not for therapeutic Use.
Pseudohypericin(Cat No.:R072689)is a natural anthraquinone derivative found in Hypericum perforatum (St. John’s Wort), known for its antiviral, antioxidant, and potential antidepressant properties. It exhibits activity against enveloped viruses by disrupting viral replication processes, making it a focus in antiviral research. Additionally, its antioxidant effects contribute to its exploration in neuroprotection and mood regulation studies. Pseudohypericin is also studied for its photodynamic properties, offering potential applications in phototherapy for certain medical conditions. This compound is a valuable tool in natural product research and therapeutic development.
CAS Number | 55954-61-5 |
Molecular Formula | C30H16O9 |
Purity | ≥95% |
Target | HIV |
IUPAC Name | 9,11,13,16,18,20-hexahydroxy-5-(hydroxymethyl)-24-methyloctacyclo[13.11.1.12,10.03,8.04,25.019,27.021,26.014,28]octacosa-1(26),2,4(25),5,8,10,12,14(28),15(27),16,18,20,23-tridecaene-7,22-dione |
InChI | InChI=1S/C30H16O9/c1-7-2-9(32)19-23-15(7)16-8(6-31)3-10(33)20-24(16)28-26-18(12(35)5-14(37)22(26)30(20)39)17-11(34)4-13(36)21(29(19)38)25(17)27(23)28/h2-5,31,34-39H,6H2,1H3 |
InChIKey | NODGUBIGZKATOM-UHFFFAOYSA-N |
SMILES | CC1=CC(=O)C2=C(C3=C(C=C(C4=C3C5=C2C1=C6C(=CC(=O)C7=C(C8=C(C=C(C4=C8C5=C67)O)O)O)CO)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |