For research use only. Not for therapeutic Use.
Pseudolaric Acid B(Cat No.:R066120)is a diterpenoid compound extracted from the roots of Pseudolarix kaempferi, a traditional Chinese medicinal plant. Known for its potent antifungal, antitumor, and anti-inflammatory properties, it disrupts microtubule dynamics, inhibiting fungal growth and cancer cell proliferation. Pseudolaric Acid B has shown promise in combating drug-resistant fungal infections and as a potential chemotherapeutic agent. Additionally, it exhibits immunomodulatory effects, making it a candidate for treating inflammatory diseases. Its diverse biological activities highlight its importance in pharmaceutical research and traditional medicine.
CAS Number | 82508-31-4 |
Synonyms | PAB |
Molecular Formula | C₂₃H₂₈O₈ |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (2E,4E)-5-[(1R,7S,8S,9R)-7-acetyloxy-4-methoxycarbonyl-9-methyl-11-oxo-10-oxatricyclo[6.3.2.01,7]tridec-3-en-9-yl]-2-methylpenta-2,4-dienoic acid |
InChI | InChI=1S/C23H28O8/c1-14(18(25)26)6-5-10-21(3)17-9-12-22(20(28)31-21)11-7-16(19(27)29-4)8-13-23(17,22)30-15(2)24/h5-7,10,17H,8-9,11-13H2,1-4H3,(H,25,26)/b10-5+,14-6+/t17-,21+,22+,23-/m0/s1 |
InChIKey | VDGOFNMYZYBUDT-YDRCMHEVSA-N |
SMILES | C/C(=C\C=C\[C@@]1([C@@H]2CC[C@@]3([C@@]2(CCC(=CC3)C(=O)OC)OC(=O)C)C(=O)O1)C)/C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |