For research use only. Not for therapeutic Use.
Pseudomonic acid C（Cat No.:R018278）is a potent antibiotic derived from Pseudomonas fluorescens, known for its effectiveness against a broad spectrum of Gram-positive bacteria. It works by inhibiting protein synthesis, targeting bacterial ribosomes and disrupting the translation process. Pseudomonic acid C is especially useful in the treatment of infections caused by resistant bacterial strains, making it an important compound in antimicrobial research. Its unique mechanism of action offers an alternative to traditional antibiotics, with potential applications in both clinical and research settings to combat bacterial resistance and improve therapeutic outcomes.
| CAS Number | 71980-98-8 |
| Synonyms | 9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid |
| Molecular Formula | C26H44O8 |
| Purity | ≥95% |
| IUPAC Name | 9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid |
| InChI | InChI=1S/C26H44O8/c1-18(16-24(30)33-14-9-7-5-4-6-8-13-23(28)29)15-22-26(32)25(31)21(17-34-22)12-10-11-19(2)20(3)27/h10-11,16,19-22,25-27,31-32H,4-9,12-15,17H2,1-3H3,(H,28,29)/b11-10+,18-16+/t19-,20+,21+,22+,25-,26+/m1/s1 |
| InChIKey | KKMHFUKZHJOMJL-WZLBZGCNSA-N |
| SMILES | C[C@H](/C=C/C[C@H]1CO[C@H]([C@@H]([C@@H]1O)O)C/C(=C/C(=O)OCCCCCCCCC(=O)O)/C)[C@H](C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
