For research use only. Not for therapeutic Use.
Pseudopelletierine (Cat. No: R011225) is a plant extract that can be used as an intermediate in pharmaceutical synthesis and organic synthesis. It is mainly used in laboratory research and chemical pharmaceutical synthesis processes.
| CAS Number | 552-70-5 |
| Synonyms | 9-Methyl-9-azabicyclo[3.3.1]nonan-3-one; 9-Methyl-3-granataninone; Granatan-3-one; NSC 116056; Pseudopelletierin; Pseudopunicine; |
| Molecular Formula | C9H15NO |
| Purity | ≥95% |
| Storage | 4°C |
| IUPAC Name | 9-methyl-9-azabicyclo[3.3.1]nonan-3-one |
| InChI | InChI=1S/C9H15NO/c1-10-7-3-2-4-8(10)6-9(11)5-7/h7-8H,2-6H2,1H3 |
| InChIKey | RHWSKVCZXBAWLZ-UHFFFAOYSA-N |
| SMILES | CN1C2CCCC1CC(=O)C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
