For research use only. Not for therapeutic Use.
Pseudothymidine（Cat No.:I020477）is a synthetic nucleoside analog structurally similar to thymidine. It incorporates into DNA and RNA during replication and transcription, which makes it useful in studying nucleic acid metabolism and synthetic biology. Its altered structure offers increased stability and resistance to enzymatic degradation, making it a valuable tool in biochemical research. Pseudothymidine’s ability to mimic thymidine while imparting unique properties has potential applications in developing novel therapeutic strategies, including antiviral treatments and cancer therapies, by interfering with cellular or viral DNA replication.
| Catalog Number | I020477 |
| CAS Number | 65358-15-8 |
| Molecular Formula | C₁₀H₁₄N₂O₅ |
| Purity | ≥95% |
| Target | Nucleoside Antimetabolite/Analog; HIV |
| IUPAC Name | 5-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione |
| InChI | CN1C=C(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O |
| InChIKey | AMDJRICBYOAHBZ-XLPZGREQSA-N |
| SMILES | InChI=1S/C10H14N2O5/c1-12-3-5(9(15)11-10(12)16)7-2-6(14)8(4-13)17-7/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1 |
| Reference | [1]. S Lutz, et al. An in vitro screening technique for DNA polymerases that can incorporate modified nucleotides. Pseudo-thymidine as a substrate for thermostable polymerases. Nucleic Acids Res. 1999 Jul 1; 27(13): 2792-2798.<br>[2]. Havemann SA, et al. Incorporation of multiple sequential pseudothymidines by DNA polymerases and their impact on DNA duplex structure. Nucleosides Nucleotides Nucleic Acids. 2008 Mar;27(3):261-78. |
