For research use only. Not for therapeutic Use.
PSI-6206（Cat No.:I005176）is a nucleoside analog prodrug developed as a potential antiviral agent targeting hepatitis C virus (HCV). It inhibits the NS5B RNA-dependent RNA polymerase, a key enzyme in the HCV replication process, by incorporating into viral RNA and causing chain termination. PSI-6206 exhibits broad-spectrum activity against multiple HCV genotypes, making it a promising candidate for therapeutic development. It has been studied for its efficacy, resistance profile, and role in combination therapies. PSI-6206 contributes significantly to research on nucleoside analogs and antiviral strategies for managing chronic HCV infections.
| CAS Number | 863329-66-2 |
| Synonyms | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
| Molecular Formula | C10H13FN2O5 |
| Purity | ≥95% |
| Target | HCV |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | N/A |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
| InChI | InChI=1S/C10H13FN2O5/c1-10(11)7(16)5(4-14)18-8(10)13-3-2-6(15)12-9(13)17/h2-3,5,7-8,14,16H,4H2,1H3,(H,12,15,17)/t5-,7-,8-,10-/m1/s1 |
| InChIKey | ARKKGZQTGXJVKW-VPCXQMTMSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)CO)O)F |
