For research use only. Not for therapeutic Use.
Psoralen (Cat No.: I004520) is a compound known for its ability to enhance melanin production in the skin. When exposed to ultraviolet light, it can induce a phototoxic reaction and selectively impede DNA synthesis in epidermal cells. Psoralen also demonstrates substantial inhibitory effects on various cancer cell lines, including S180, Ehrlich ascites carcinoma, and liver cancer H-22. This dual action, both in enhancing pigmentation and inhibiting cancer cell growth, underscores its versatility and potential applications in dermatology and oncology.
CAS Number | 66-97-7 |
Synonyms | Ficusin;Furocoumarin;NSC 404562 |
Molecular Formula | C11H6O3 |
Purity | ≥95% |
Target | Anti-infection |
Solubility | DMSO: ≥ 1.9 mg/mL |
Storage | 2-8°C |
IUPAC Name | furo[3,2-g]chromen-7-one |
InChI | InChI=1S/C11H6O3/c12-11-2-1-7-5-8-3-4-13-9(8)6-10(7)14-11/h1-6H |
InChIKey | ZCCUUQDIBDJBTK-UHFFFAOYSA-N |
SMILES | C1=CC(=O)OC2=CC3=C(C=CO3)C=C21 |