For research use only. Not for therapeutic Use.
Psoralenoside is a naturally occurring furanocoumarin glycoside found in certain plants, particularly in the Apiaceae and Rutaceae families. It is a derivative of psoralen, a compound known for its phototoxic and phototherapeutic properties. Psoralenoside itself is less active than psoralen but is of interest in phytochemical studies due to its potential anti-inflammatory, antioxidant, and skin-protective effects. Research into psoralenoside focuses on its role in plant metabolism and its potential therapeutic applications, particularly in skin-related conditions and as a natural antioxidant.
| Catalog Number | I010416 |
| CAS Number | 905954-17-8 |
| Synonyms | (Z)-3-[6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-benzofuran-5-yl]prop-2-enoic acid |
| Molecular Formula | C17H18O9 |
| Purity | ≥95% |
| InChI | InChI=1S/C17H18O9/c18-7-12-14(21)15(22)16(23)17(26-12)25-11-6-10-9(3-4-24-10)5-8(11)1-2-13(19)20/h1-6,12,14-18,21-23H,7H2,(H,19,20)/b2-1-/t12-,14-,15+,16-,17-/m1/s1 |
| InChIKey | XRLPSAYLYDMYGX-UETKAVOHSA-N |
| SMILES | C1=COC2=CC(=C(C=C21)C=CC(=O)O)OC3C(C(C(C(O3)CO)O)O)O |
