For research use only. Not for therapeutic Use.
PTC-028 is an orally bioavailable compound that decreases BMI-1 levels by posttranslational modification. In vivo, orally administered PTC-028, as a single agent, exhibits significant antitumor activity comparable with the standard cisplatin/paclitaxel therapy in an orthotopic mouse model of ovarian cancer.
| Catalog Number | I014656 |
| CAS Number | 1782970-28-8 |
| Synonyms | PTC-028; PTC028; PTC 028;2-Pyrazinamine, 6-(5,6-difluoro-2-methyl-1H-benzimidazol-1-yl)-N-[4-(trifluoromethyl)phenyl]- |
| Molecular Formula | C19H12F5N5 |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | Soluble in DMSO |
| InChI | InChI=1S/C19H12F5N5/c1-10-26-15-6-13(20)14(21)7-16(15)29(10)18-9-25-8-17(28-18)27-12-4-2-11(3-5-12)19(22,23)24/h2-9H,1H3,(H,27,28) |
| InChIKey | JEZGPBWIZWPDHP-UHFFFAOYSA-N |
| SMILES | FC(C1=CC=C(NC2=NC(N3C4=CC(F)=C(F)C=C4N=C3C)=CN=C2)C=C1)(F)F |
| Reference | </br>Dey A, et al. Mol Cancer Ther. 2018, 17(1):39-49. </br> |
