For research use only. Not for therapeutic Use.
Pterosin A(CAT: I040862) is a naturally occurring sesquiterpene compound derived from Pteridium aquilinum (bracken fern) and other plant sources. It has been studied for its diverse pharmacological properties, including anti-inflammatory, anti-diabetic, and anticancer activities. Pterosin A has demonstrated potential in modulating metabolic pathways, inhibiting tumor cell proliferation, and reducing oxidative stress, making it a promising candidate for research in metabolic disorders, oncology, and inflammation-related diseases. With its unique bioactive profile, Pterosin A serves as a valuable tool for drug discovery and the development of novel therapeutic agents in various disease areas.
CAS Number | 35910-16-8 |
Synonyms | (2S)-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-3H-inden-1-one |
Molecular Formula | C15H20O3 |
Purity | ≥95% |
IUPAC Name | (2S)-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-3H-inden-1-one |
InChI | InChI=1S/C15H20O3/c1-9-6-11-7-15(3,8-17)14(18)13(11)10(2)12(9)4-5-16/h6,16-17H,4-5,7-8H2,1-3H3/t15-/m0/s1 |
InChIKey | BDZJLPDYMKPKGC-HNNXBMFYSA-N |
SMILES | CC1=CC2=C(C(=C1CCO)C)C(=O)C(C2)(C)CO |