For research use only. Not for therapeutic Use.
Pterosin B is a natural compound belonging to the pterosin family of chemicals found in certain ferns. It exhibits antitumor and cytotoxic properties, making it a subject of interest in cancer research. Pterosin B functions by interfering with cellular processes involved in tumor growth and proliferation. Research aims to elucidate its mechanisms of action and explore its potential as a therapeutic agent against cancer. Pterosin B represents a promising lead compound for developing novel anticancer treatments derived from natural sources.
CAS Number | 34175-96-7 |
Molecular Formula | C14H18O2 |
Purity | ≥95% |
Target | Salt-inducible Kinase (SIK) |
Storage | -20°C |
IUPAC Name | (2R)-6-(2-hydroxyethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one |
InChI | InChI=1S/C14H18O2/c1-8-6-11-7-9(2)14(16)13(11)10(3)12(8)4-5-15/h6,9,15H,4-5,7H2,1-3H3/t9-/m1/s1 |
InChIKey | SJNCSXMTBXDZQA-SECBINFHSA-N |
SMILES | CC1CC2=CC(=C(C(=C2C1=O)C)CCO)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |