For research use only. Not for therapeutic Use.
PTI-428（Cat No.:I019406） is a small molecule compound that functions as a cystic fibrosis transmembrane conductance regulator (CFTR) amplifier. It has been developed as a potential therapeutic for cystic fibrosis (CF), a genetic disorder characterized by defective CFTR protein function. PTI-428 works by enhancing CFTR protein synthesis, stability, and trafficking to the cell surface, leading to increased CFTR activity.
| Catalog Number | I019406 |
| CAS Number | 1953130-87-4 |
| Molecular Formula | C₁₈H₁₈N₄O₄ |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | N-[3-[5-[(1R)-1-hydroxyethyl]-1,3,4-oxadiazol-2-yl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide |
| InChI | InChI=1S/C18H18N4O4/c1-10(23)17-20-21-18(25-17)12-7-13(8-12)19-16(24)15-9-14(22-26-15)11-5-3-2-4-6-11/h2-6,9-10,12-13,23H,7-8H2,1H3,(H,19,24)/t10-,12?,13?/m1/s1 |
| InChIKey | XPEHHUISIBFLHX-QFWMXSHPSA-N |
| SMILES | CC(C1=NN=C(O1)C2CC(C2)NC(=O)C3=CC(=NO3)C4=CC=CC=C4)O |
| Reference | [1]. Mijnders M, et al. Correcting CFTR folding defects by small-molecule correctors to cure cystic fibrosis. Curr Opin Pharmacol. 2017 Jun;34:83-90. |
