For research use only. Not for therapeutic Use.
PTP Inhibitor IV（Cat No.:I011771）is a small molecule compound designed to selectively inhibit protein tyrosine phosphatases (PTPs), a family of enzymes that regulate cellular signaling by dephosphorylating tyrosine residues on proteins. By inhibiting PTPs, PTP Inhibitor IV can modulate important cellular processes such as cell growth, differentiation, and immune responses. This compound has potential therapeutic applications in treating diseases associated with dysregulated tyrosine phosphorylation, including cancer, autoimmune disorders, and neurodegenerative diseases. Ongoing research is focused on understanding its mechanism of action and evaluating its efficacy in various disease models.
| CAS Number | 329317-98-8 |
| Synonyms | 1,1,1-trifluoro-N-[4-[2-[4-[2-[4-(trifluoromethylsulfonylamino)phenyl]propan-2-yl]phenyl]propan-2-yl]phenyl]methanesulfonamide |
| Molecular Formula | C26H26F6N2O4S2 |
| Purity | ≥95% |
| IUPAC Name | 1,1,1-trifluoro-N-[4-[2-[4-[2-[4-(trifluoromethylsulfonylamino)phenyl]propan-2-yl]phenyl]propan-2-yl]phenyl]methanesulfonamide |
| InChI | InChI=1S/C26H26F6N2O4S2/c1-23(2,19-9-13-21(14-10-19)33-39(35,36)25(27,28)29)17-5-7-18(8-6-17)24(3,4)20-11-15-22(16-12-20)34-40(37,38)26(30,31)32/h5-16,33-34H,1-4H3 |
| InChIKey | JWNAVYMNAQDLHX-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C(C)(C)C2=CC=C(C=C2)NS(=O)(=O)C(F)(F)F)C3=CC=C(C=C3)NS(=O)(=O)C(F)(F)F |
