For research use only. Not for therapeutic Use.
PTPD (Cat.No:I012283) is a chemical compound that functions as a potent and selective inhibitor of protein tyrosine phosphatase (PTP1B). This enzyme plays a critical role in regulating cellular signaling pathways, including those related to insulin and leptin receptors. PTPD has potential therapeutic implications in treating obesity and diabetes by enhancing insulin sensitivity.
| Catalog Number | I012283 |
| CAS Number | 1422057-40-6 |
| Synonyms | 3-Hydroxy-5-methyl-1-phenylthieno[2,3-d]pyrimidine-2,4(1H,3H)-dione |
| Molecular Formula | C13H10N2O3S |
| Purity | ≥95% |
| IUPAC Name | 3-hydroxy-5-methyl-1-phenylthieno[2,3-d]pyrimidine-2,4-dione |
| InChI | InChI=1S/C13H10N2O3S/c1-8-7-19-12-10(8)11(16)15(18)13(17)14(12)9-5-3-2-4-6-9/h2-7,18H,1H3 |
| InChIKey | QKYZQKJXAKNEPA-UHFFFAOYSA-N |
| SMILES | CC1=CSC2=C1C(=O)N(C(=O)N2C3=CC=CC=C3)O |
