For research use only. Not for therapeutic Use.
PTPN2/1-IN-2 is a PTPN2/1 antagonist that can be used in various tumor research[1].
| Catalog Number | I041083 |
| CAS Number | 2407611-02-1 |
| Synonyms | 5-[1-fluoro-3-hydroxy-7-(3-hydroxy-3-methylbutoxy)naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| Molecular Formula | C17H19FN2O6S |
| Purity | ≥95% |
| InChI | InChI=1S/C17H19FN2O6S/c1-17(2,23)5-6-26-11-4-3-10-7-13(21)16(15(18)12(10)8-11)20-9-14(22)19-27(20,24)25/h3-4,7-8,21,23H,5-6,9H2,1-2H3,(H,19,22) |
| InChIKey | KJYRSQLWJMEJNM-UHFFFAOYSA-N |
| SMILES | CC(C)(CCOC1=CC2=C(C(=C(C=C2C=C1)O)N3CC(=O)NS3(=O)=O)F)O |
| Reference | [1]. Elliot FARNEY, et al. Protein tyrosine phosphatase inhibitors and methods of use thereof.WO2019246513. |
