For research use only. Not for therapeutic Use.
PTPN2/1-IN-2(Cat No.:I041083)is a small molecule inhibitor targeting the protein tyrosine phosphatases PTPN2 and PTPN1, which are involved in regulating immune cell signaling and cellular processes related to inflammation. By inhibiting these enzymes, PTPN2/1-IN-2 can modulate immune responses and has potential therapeutic applications in autoimmune diseases and cancer. Its ability to selectively block PTPN2 and PTPN1 activity may lead to the development of targeted therapies for conditions such as rheumatoid arthritis, inflammatory bowel disease, and certain cancers, by reducing excessive immune activation and promoting immune regulation.
CAS Number | 2407611-02-1 |
Synonyms | 5-[1-fluoro-3-hydroxy-7-(3-hydroxy-3-methylbutoxy)naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
Molecular Formula | C17H19FN2O6S |
Purity | ≥95% |
IUPAC Name | 5-[1-fluoro-3-hydroxy-7-(3-hydroxy-3-methylbutoxy)naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
InChI | InChI=1S/C17H19FN2O6S/c1-17(2,23)5-6-26-11-4-3-10-7-13(21)16(15(18)12(10)8-11)20-9-14(22)19-27(20,24)25/h3-4,7-8,21,23H,5-6,9H2,1-2H3,(H,19,22) |
InChIKey | KJYRSQLWJMEJNM-UHFFFAOYSA-N |
SMILES | CC(C)(CCOC1=CC2=C(C(=C(C=C2C=C1)O)N3CC(=O)NS3(=O)=O)F)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |