For research use only. Not for therapeutic Use.
PU 02（Cat No.:I011007）is a small-molecule inhibitor that has been studied for its role in cancer research, specifically targeting heat shock protein 90 (Hsp90), a molecular chaperone involved in stabilizing and activating numerous oncogenic proteins. By inhibiting Hsp90, PU 02 disrupts the folding and function of its client proteins, leading to the degradation of key proteins involved in cancer cell growth and survival. This makes PU 02 a valuable tool in understanding Hsp90’s role in cancer progression and exploring new therapeutic strategies for targeting oncogenic pathways in various cancers.
| Catalog Number | I011007 |
| CAS Number | 313984-77-9 |
| Synonyms | 6-[(1-Naphthalenylmethyl)thio]-9H-purine |
| Molecular Formula | C16H12N4S |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | 2-8°C |
| IUPAC Name | 6-(naphthalen-1-ylmethylsulfanyl)-7H-purine |
| InChI | InChI=1S/C16H12N4S/c1-2-7-13-11(4-1)5-3-6-12(13)8-21-16-14-15(18-9-17-14)19-10-20-16/h1-7,9-10H,8H2,(H,17,18,19,20) |
| InChIKey | BGMSTNYJYPSLHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CSC3=NC=NC4=C3NC=N4 |
