For research use only. Not for therapeutic Use.
PU.1-IN-1（Cat No.:I041109）is a small molecule inhibitor that targets the transcription factor PU.1, which plays a crucial role in the differentiation and function of immune cells, particularly in hematopoiesis and immune responses. By inhibiting PU.1, PU.1-IN-1 can influence immune cell development and has potential therapeutic applications in diseases involving immune system dysfunction, such as certain cancers, autoimmune diseases, and inflammatory conditions. Preclinical studies are exploring its ability to modulate immune responses, and ongoing research aims to assess its efficacy and safety in treating various immune-related disorders and malignancies.
| CAS Number | 873588-27-3 |
| Synonyms | 4-cyclohexyl-N-(pyridin-4-ylmethyl)benzenesulfonamide |
| Molecular Formula | C18H22N2O2S |
| Purity | ≥95% |
| IUPAC Name | 4-cyclohexyl-N-(pyridin-4-ylmethyl)benzenesulfonamide |
| InChI | InChI=1S/C18H22N2O2S/c21-23(22,20-14-15-10-12-19-13-11-15)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h6-13,16,20H,1-5,14H2 |
| InChIKey | HRBIOWBGGRSAGZ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC=C(C=C2)S(=O)(=O)NCC3=CC=NC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
