For research use only. Not for therapeutic Use.
Pulcherriminic acid（Cat No.:I043277）is a natural compound produced by certain fungi, particularly Aureobasidium pullulans. It is a secondary metabolite that has a distinct red pigmentation and plays a role in the organism’s interaction with its environment. Pulcherriminic acid forms a complex with iron ions, which can inhibit the growth of competing microbes. It has gained attention for its potential antimicrobial and antioxidant properties, as well as its use in the production of dyes. Additionally, research suggests that it may have applications in medicine due to its biological activity.
| CAS Number | 957-86-8 |
| Synonyms | 1,5-dihydroxy-3,6-bis(2-methylpropyl)-4-oxidopyrazin-4-ium-2-one |
| Molecular Formula | C12H20N2O4 |
| Purity | ≥95% |
| IUPAC Name | 1,5-dihydroxy-3,6-bis(2-methylpropyl)-4-oxidopyrazin-4-ium-2-one |
| InChI | InChI=1S/C12H20N2O4/c1-7(2)5-9-11(15)14(18)10(6-8(3)4)12(16)13(9)17/h7-8,15,17H,5-6H2,1-4H3 |
| InChIKey | BUHPPQFOKKRDPX-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=C([N+](=C(C(=O)N1O)CC(C)C)[O-])O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
