For research use only. Not for therapeutic Use.
Puliginurad（Cat No.:I043391）is a selective urate transporter inhibitor that works by reducing uric acid levels in the bloodstream. It specifically targets the URAT1 (urate transporter 1) protein, which is responsible for reabsorbing uric acid in the kidneys. By inhibiting URAT1, Puliginurad enhances the excretion of uric acid, making it a potential therapeutic option for managing gout and hyperuricemia, conditions characterized by high levels of uric acid. This compound is being studied for its ability to reduce the frequency of gout attacks and help manage chronic uric acid-related diseases more effectively.
| CAS Number | 2013582-27-7 |
| Synonyms | 3-[4-(4-cyanophenyl)thieno[2,3-c]pyridin-2-yl]-2,2-dimethylpropanoic acid |
| Molecular Formula | C19H16N2O2S |
| Purity | ≥95% |
| IUPAC Name | 3-[4-(4-cyanophenyl)thieno[2,3-c]pyridin-2-yl]-2,2-dimethylpropanoic acid |
| InChI | InChI=1S/C19H16N2O2S/c1-19(2,18(22)23)8-14-7-15-16(10-21-11-17(15)24-14)13-5-3-12(9-20)4-6-13/h3-7,10-11H,8H2,1-2H3,(H,22,23) |
| InChIKey | QWCZAFGDQBUAFT-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC2=C(S1)C=NC=C2C3=CC=C(C=C3)C#N)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
