For research use only. Not for therapeutic Use.
Purmorphamine（Cat No.:I003702） is a compound that interacts directly with Smoothened (Smo), a key component of the Hedgehog signaling pathway. It functions by binding to Smo, inhibiting the binding of BODIPY-cyclopamine to Smo with an IC50 of approximately 1.5 μM. Additionally, purmorphamine acts as an inducer of osteoblast differentiation, promoting the formation of bone-forming cells. Its osteogenic activity is demonstrated by an EC50 of 1 μM, indicating its potential therapeutic application in promoting bone regeneration and treating bone-related disorders.
| Catalog Number | I003702 |
| CAS Number | 483367-10-8 |
| Synonyms | 9-cyclohexyl-N-(4-morpholin-4-ylphenyl)-2-naphthalen-1-yloxypurin-6-amine |
| Molecular Formula | C31H32N6O2 |
| Purity | ≥95% |
| Target | Smoothened |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | 1.5 uM |
| IUPAC Name | 9-cyclohexyl-N-(4-morpholin-4-ylphenyl)-2-naphthalen-1-yloxypurin-6-amine |
| InChI | InChI=1S/C31H32N6O2/c1-2-9-25(10-3-1)37-21-32-28-29(33-23-13-15-24(16-14-23)36-17-19-38-20-18-36)34-31(35-30(28)37)39-27-12-6-8-22-7-4-5-11-26(22)27/h4-8,11-16,21,25H,1-3,9-10,17-20H2,(H,33,34,35) |
| InChIKey | FYBHCRQFSFYWPY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2C=NC3=C(N=C(N=C32)OC4=CC=CC5=CC=CC=C54)NC6=CC=C(C=C6)N7CCOCC7 |
