For research use only. Not for therapeutic Use.
PVZB1194（Cat No.:I012281）is a small molecule compound under investigation for its potential therapeutic applications, particularly in the field of oncology. It is designed to target specific pathways involved in cancer cell proliferation and survival. Preclinical studies suggest that PVZB1194 may inhibit tumor growth by interfering with crucial molecular processes that support cancer cell viability, such as angiogenesis or cell cycle progression. Ongoing research is focused on evaluating its efficacy, safety, and potential use in combination with other cancer treatments to enhance its therapeutic benefits in various cancer types.
| CAS Number | 1141768-04-8 |
| Synonyms | 4-[3-fluoro-4-(trifluoromethyl)phenyl]benzenesulfonamide |
| Molecular Formula | C13H9F4NO2S |
| Purity | ≥95% |
| IUPAC Name | 4-[3-fluoro-4-(trifluoromethyl)phenyl]benzenesulfonamide |
| InChI | InChI=1S/C13H9F4NO2S/c14-12-7-9(3-6-11(12)13(15,16)17)8-1-4-10(5-2-8)21(18,19)20/h1-7H,(H2,18,19,20) |
| InChIKey | UEPKMFLFRNDVAW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)C(F)(F)F)F)S(=O)(=O)N |
