For research use only. Not for therapeutic Use.
PXD101, also known as Belinostat, is a potent HDAC inhibitor used in advanced cancer research and treatment. This compound plays a crucial role in studying epigenetic modifications, cell cycle regulation, and apoptosis in cancer cells. Its application in clinical trials and drug development highlights its potential in treating various malignancies, including lymphoma and solid tumors. Ideal for oncology research, PXD101 enhances the understanding of histone deacetylase inhibition and its therapeutic implications, making it indispensable for innovative cancer treatment strategies.
CAS Number | 414864-00-9 |
Synonyms | NSC726630, PX-105684; PXD101 |
Molecular Formula | C15H14N2O4S |
Purity | ≥95% |
Target | HDAC |
Solubility | >15.9mg/mL in DMSO |
IUPAC Name | (E)-N-hydroxy-3-[3-(phenylsulfamoyl)phenyl]prop-2-enamide |
InChI | InChI=1S/C15H14N2O4S/c18-15(16-19)10-9-12-5-4-8-14(11-12)22(20,21)17-13-6-2-1-3-7-13/h1-11,17,19H,(H,16,18)/b10-9+ |
InChIKey | NCNRHFGMJRPRSK-MDZDMXLPSA-N |
SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=CC(=C2)C=CC(=O)NO |
Reference | 1: Qian X, Ara G, Mills E, LaRochelle WJ, Lichenstein HS, Jeffers M. Activity of 2: Tumber A, Collins LS, Petersen KD, Thougaard A, Christiansen SJ, Dejligbjerg 3: Qian X, LaRochelle WJ, Ara G, Wu F, Petersen KD, Thougaard A, Sehested M, 4: Plumb JA, Finn PW, Williams RJ, Bandara MJ, Romero MR, Watkins CJ, La Thangue |