For research use only. Not for therapeutic Use.
PXYC1（Cat No.:I043550）is a selective small molecule inhibitor that targets a specific protein involved in regulating cellular processes such as cell division, survival, and migration. Though the exact molecular target of PXYC1 is still under investigation, it is believed to influence key signaling pathways involved in cancer cell proliferation and metastasis. By modulating these pathways, PXYC1 aims to reduce tumor growth, suppress metastasis, and potentially enhance the efficacy of existing cancer treatments. This compound is being studied for its therapeutic potential in oncology, offering a targeted approach to cancer therapy.
| CAS Number | 865098-81-3 |
| Synonyms | ethyl 2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]acetate |
| Molecular Formula | C9H10N4O3S |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]acetate |
| InChI | InChI=1S/C9H10N4O3S/c1-2-16-5(14)3-17-9-12-7-6(8(15)13-9)10-4-11-7/h4H,2-3H2,1H3,(H2,10,11,12,13,15) |
| InChIKey | YUQGXHIIAOIQEZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CSC1=NC2=C(C(=O)N1)NC=N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
