For research use only. Not for therapeutic Use.
PYCR1-IN-1(CAT: I040704) is a selective small-molecule inhibitor of Pyrroline-5-carboxylate reductase 1 (PYCR1), an enzyme involved in proline biosynthesis and cellular redox homeostasis. PYCR1 is often upregulated in various cancers, where it supports tumor cell survival, proliferation, and metabolic adaptation. PYCR1-IN-1 disrupts proline metabolism, leading to impaired mitochondrial function and increased oxidative stress in cancer cells. This compound is a valuable tool for studying the role of proline metabolism in tumor biology and evaluating PYCR1 as a potential therapeutic target. PYCR1-IN-1 is suitable for use in cancer metabolism research and preclinical drug discovery applications.
| CAS Number | 709-85-3 |
| Synonyms | N-[(4-bromophenyl)methyl]-N-methylprop-2-yn-1-amine |
| Molecular Formula | C11H12BrN |
| Purity | ≥95% |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N-methylprop-2-yn-1-amine |
| InChI | InChI=1S/C11H12BrN/c1-3-8-13(2)9-10-4-6-11(12)7-5-10/h1,4-7H,8-9H2,2H3 |
| InChIKey | CZHICGIAKKAMAP-UHFFFAOYSA-N |
| SMILES | CN(CC#C)CC1=CC=C(C=C1)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
