For research use only. Not for therapeutic Use.
Pyocyanin(CAT: I011433) is a blue-green pigment produced by the bacterium Pseudomonas aeruginosa, which is known to cause various infections in humans. It is a secondary metabolite and is primarily involved in the virulence and pathogenicity of the bacteria. Pyocyanin is produced by Pseudomonas aeruginosa in response to oxidative stress and is involved in the formation of biofilms, which can contribute to antibiotic resistance. Pyocyanin has also been shown to have cytotoxic effects on human cells and can induce oxidative stress and inflammation.
| Catalog Number | I011433 |
| CAS Number | 85-66-5 |
| Synonyms | 5-methyl-1(5H)-phenazinone |
| Molecular Formula | C13H10N2O |
| Purity | ≥95% |
| Target | AhR |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 5-methylphenazin-1-one |
| InChI | InChI=1S/C13H10N2O/c1-15-10-6-3-2-5-9(10)14-13-11(15)7-4-8-12(13)16/h2-8H,1H3 |
| InChIKey | YNCMLFHHXWETLD-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2N=C3C1=CC=CC3=O |
