For research use only. Not for therapeutic Use.
Pyrantel pamoate（Cat No.:I002698）is a widely used anthelmintic medication effective against various intestinal parasites, including pinworms, roundworms, and hookworms. It acts as a neuromuscular blocker, causing paralysis in parasites by stimulating acetylcholine receptors, leading to their detachment from the host’s intestinal walls and eventual expulsion. Known for its safety and effectiveness, pyrantel pamoate is commonly used in both human and veterinary medicine. Due to its targeted action on parasites with minimal absorption into the bloodstream, it’s an ideal treatment for gastrointestinal worm infections, making it valuable in parasite control.
| Catalog Number | I002698 |
| CAS Number | 22204-24-6 |
| Molecular Formula | C34H30N2O6S |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | DMSO: ≥ 35 mg/mL |
| Storage | Store at -20C |
| IUPAC Name | 4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid;1-methyl-2-[(E)-2-thiophen-2-ylethenyl]-5,6-dihydro-4H-pyrimidine |
| InChI | InChI=1S/C23H16O6.C11H14N2S/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;1-13-8-3-7-12-11(13)6-5-10-4-2-9-14-10/h1-10,24-25H,11H2,(H,26,27)(H,28,29);2,4-6,9H,3,7-8H2,1H3/b;6-5+ |
| InChIKey | AQXXZDYPVDOQEE-MXDQRGINSA-N |
| SMILES | CN1CCCN=C1/C=C/C2=CC=CS2.C1=CC=C2C(=C1)C=C(C(=C2CC3=C(C(=CC4=CC=CC=C43)C(=O)O)O)O)C(=O)O |
| Reference | <p style=/line-height:25px/> |
