For research use only. Not for therapeutic Use.
Pyranthrene(Cat No.:M067204), is a polycyclic aromatic hydrocarbon (PAH) compound. It is a fused-ring structure consisting of four benzene rings in a linear arrangement. Pyranthrene is part of a group of chemicals known for their environmental persistence and potential toxicity. While not widely studied individually, PAHs like phenanthrene are often used as indicators for environmental pollution due to their presence in combustion byproducts, such as soot and tar. They can be found in air, water, soil, and sediments and are a subject of concern due to their possible carcinogenicity and ecological impact, particularly in polluted environments and contaminated sites.
CAS Number | 191-13-9 |
Molecular Formula | C30H16 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | pyranthrene |
InChI | InChI=1S/C30H16/c1-3-7-23-17(5-1)13-19-9-11-22-16-26-24-8-4-2-6-18(24)14-20-10-12-21-15-25(23)27(19)29(22)30(21)28(20)26/h1-16H |
InChIKey | LNKHTYQPVMAJSF-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=C3C=CC4=CC5=C6C(=CC7=CC=CC=C75)C=CC8=CC2=C3C4=C86 |