Pyrazinamide-15N,d3（Cat No.:R010570） is a high-purity isotopically labeled compound essential for advanced pharmaceutical and biochemical research. This version of Pyrazinamide features one nitrogen-15 and three deuterium atoms, enhancing its stability and precision in analytical applications. It is crucial for studies involving tuberculosis treatment, drug metabolism, and pharmacokinetics. The stable isotope labeling ensures accurate and reliable results, making it ideal for various experimental setups. Perfect for infectious disease research and drug development, Pyrazinamide-15N,d3 integrates seamlessly into existing protocols, providing a robust solution for high-precision scientific investigations.
| Catalog Number | R010570 |
| CAS Number | 1246817-81-1 |
| Synonyms | Pirazinecarboxamide-15N,d3; Pyrazinoic Acid Amide-15N,d3; D-50-15N,d3; Pezetamid-15N,d3; Pyrafat-15N,d3; Piraldina-15N,d3; Tebrazid-15N,d3; Zinamide-15N,d3; |
| Molecular Formula | C5H5N3O |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 3,5,6-trideuteriopyrazine-2-(15N)carboxamide |
| InChI | InChI=1S/C5H5N3O/c6-5(9)4-3-7-1-2-8-4/h1-3H,(H2,6,9)/i1D,2D,3D,6+1 |
| InChIKey | IPEHBUMCGVEMRF-GTNCALAVSA-N |
| SMILES | [2H]C1=C(N=C(C(=N1)[2H])C(=O)[15NH2])[2H] |
