For research use only. Not for therapeutic Use.
Pyrazine 1,4-Dioxide (Cat No.:C000739) is a chemical compound characterized by a pyrazine ring with two oxygen atoms added at positions 1 and 4. This modification can influence its chemical reactivity and properties. Pyrazine 1,4-Dioxide likely holds significance in organic synthesis as a building block or reagent. Its unique structure may facilitate the creation of diverse molecules for pharmaceuticals, materials science, or other applications.
| Catalog Number | C000739 |
| CAS Number | 2423-84-9 |
| Synonyms | Pyrazine N,N’-Dioxide; Pyrazine Di-N-oxide; Pyrazine Dioxide; |
| Molecular Formula | C₄H₄N₂O₂ |
| Purity | ≥95% |
| Solubility | Aqueous Acid (Slightly), Water (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | 4°C |
| IUPAC Name | 4-oxidopyrazin-1-ium 1-oxide |
| InChI | InChI=1S/C4H4N2O2/c7-5-1-2-6(8)4-3-5/h1-4H |
| InChIKey | SXTKIFFXFIDYJF-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=O)C=CN1[O-] |
