For research use only. Not for therapeutic Use.
Pyrazinecarboxylic Acid(Cat No.:R058164)is a nitrogen-containing heterocyclic compound valued in pharmaceutical and biochemical research. Known for its unique pyrazine ring structure, it serves as a key intermediate in synthesizing various pharmaceuticals, including antimycobacterial agents like pyrazinamide. Pyrazinecarboxylic acid is studied for its potential antimicrobial and anti-inflammatory properties, contributing to its utility in drug development and medicinal chemistry. Additionally, its structural characteristics make it useful in organic synthesis, aiding in the design of complex molecules. Its role spans across drug discovery, synthetic chemistry, and bioactivity research.
Catalog Number | R058164 |
CAS Number | 98-97-5 |
Synonyms | 2-Pyrazinecarboxylic Acid; Pyrazinoic Acid; 1,4-Diazinecarboxylic Acid; 2-Carboxypyrazine; 2-Pyrazinoic Acid; NSC 13146; NSC 27192; Pyrazinic Acid; |
Molecular Formula | C5H4N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | pyrazine-2-carboxylic acid |
InChI | InChI=1S/C5H4N2O2/c8-5(9)4-3-6-1-2-7-4/h1-3H,(H,8,9) |
InChIKey | NIPZZXUFJPQHNH-UHFFFAOYSA-N |
SMILES | C1=CN=C(C=N1)C(=O)O |