For research use only. Not for therapeutic Use.
Pyrazinedipropionic acid (CAT: I035245) is a chemical compound with diverse applications. It serves as a valuable building block in organic synthesis, allowing for the creation of complex molecules through various reactions. Due to its unique chemical structure, Pyrazinedipropionic acid can be incorporated into materials with tailored properties, making it relevant in material chemistry. Additionally, it may find use in the field of pharmaceuticals, potentially contributing to drug discovery and development.
| Catalog Number | I035245 |
| CAS Number | 77479-02-8 |
| Synonyms | 2,5-Pyrazinedipropanoic acid; |
| Molecular Formula | C10H12N2O4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 3,3'-(pyrazine-2,5-diyl)dipropionic acid |
| InChI | InChI=1S/C10H12N2O4/c13-9(14)3-1-7-5-12-8(6-11-7)2-4-10(15)16/h5-6H,1-4H2,(H,13,14)(H,15,16) |
| InChIKey | LPCBENZWRKDJSS-UHFFFAOYSA-N |
| SMILES | OC(CCc1ncc(CCC(O)=O)nc1)=O |
