For research use only. Not for therapeutic Use.
Pyrenocine A is a natural phytotoxin, inducing monopolar spindle formation and suppressing proliferation of cancer cells.
| Catalog Number | I035253 |
| CAS Number | 76868-97-8 |
| Synonyms | Pyrenocine A |
| Molecular Formula | C11H12O4 |
| Purity | 98% |
| Target | Microorganisms |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 5-[(E)-But-2-enoyl]-4-methoxy-6-methylpyran-2-one |
| InChI | InChI=1S/C11H12O4/c1-4-5-8(12)11-7(2)15-10(13)6-9(11)14-3/h4-6H,1-3H3/b5-4+ |
| InChIKey | VVYCRPVWBIEKIW-SNAWJCMRSA-N |
| SMILES | O=C1C=C(OC)C(C(/C=C/C)=O)=C(C)O1 |
