For research use only. Not for therapeutic Use.
Pyridazomycin(Cat No.:M026482), is a natural antibiotic produced by certain strains of bacteria. It is classified as a pyridazine antibiotic due to its unique chemical structure. Pyridazomycin exhibits antimicrobial activity against a range of Gram-positive bacteria, including some drug-resistant strains. Its mechanism of action involves inhibiting bacterial cell wall synthesis. This antibiotic has drawn attention in pharmaceutical research for its potential in combating antibiotic-resistant infections.
Catalog Number | M026482 |
CAS Number | 115920-43-9 |
Synonyms | Pyridazomycin |
Molecular Formula | C10H16N4O3.Cl |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | (2S)-2-amino-5-(4-carbamoylpyridazin-1-ium-1-yl)pentanoic acid;chloride |
InChI | InChI=1S/C10H14N4O3.ClH/c11-8(10(16)17)2-1-4-14-5-3-7(6-13-14)9(12)15;/h3,5-6,8H,1-2,4,11H2,(H2-,12,15,16,17);1H/t8-;/m0./s1 |
InChIKey | UNLIMPSYAWNGDA-QRPNPIFTSA-N |
SMILES | C1=C[N+](=NC=C1C(=O)N)CCCC(C(=O)O)N.[Cl-] |