For research use only. Not for therapeutic Use.
Pyridine-2-carboxaldehyde methiodide（Cat No.:C001056）is a chemical derivative of pyridine with the molecular formula C7H8INO. This compound features a pyridine ring substituted with a carboxaldehyde group at the 2-position and a methyl iodide group, enhancing its electrophilic character. It is commonly used in organic synthesis, particularly in quaternization reactions where it forms stable ionic compounds. This reagent is valuable in synthesizing heterocyclic compounds and in medicinal chemistry for introducing iodide moieties into pharmaceuticals. Its utility extends to catalysis, where it acts as an intermediate in the formation of complex organic molecules.
| Catalog Number | C001056 |
| CAS Number | 3784-97-2 |
| Synonyms | 2-Formyl-1-methylpyridinium Iodide; PCAM |
| Molecular Formula | C₇H₈INO |
| Purity | ≥95% |
| IUPAC Name | 1-methylpyridin-1-ium-2-carbaldehyde;iodide |
| InChI | InChI=1S/C7H8NO.HI/c1-8-5-3-2-4-7(8)6-9;/h2-6H,1H3;1H/q+1;/p-1 |
| InChIKey | PJOJJDGBJAIPOY-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC=CC=C1C=O.[I-] |
