For research use only. Not for therapeutic Use.
Pyridostatin（Cat No.:I000370）is a synthetic small molecule known for its ability to stabilize G-quadruplex DNA structures. This unique property makes it a valuable tool in cancer research, as G-quadruplexes are involved in the regulation of oncogenes and telomeres. Pyridostatin has shown potential in inhibiting the proliferation of cancer cells by targeting these DNA structures, leading to genomic instability and cell death. Its role in studying DNA secondary structures and developing novel anticancer therapies underscores its importance in advancing our understanding of cancer biology and treatment strategies.
| Catalog Number | I000370 |
| CAS Number | 1085412-37-8 |
| Synonyms | 4-(2-aminoethoxy)-2-N,6-N-bis[4-(2-aminoethoxy)quinolin-2-yl]pyridine-2,6-dicarboxamide |
| Molecular Formula | C31H32N8O5 |
| Purity | ≥95% |
| Target | G-quadruplex |
| Solubility | DMSO: 100 mg/mL, H2O: 100 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 4-(2-aminoethoxy)-2-N,6-N-bis[4-(2-aminoethoxy)quinolin-2-yl]pyridine-2,6-dicarboxamide |
| InChI | InChI=1S/C31H32N8O5/c32-9-12-42-19-15-24(30(40)38-28-17-26(43-13-10-33)20-5-1-3-7-22(20)36-28)35-25(16-19)31(41)39-29-18-27(44-14-11-34)21-6-2-4-8-23(21)37-29/h1-8,15-18H,9-14,32-34H2,(H,36,38,40)(H,37,39,41) |
| InChIKey | VGHSATQVJCTKEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)NC(=O)C3=CC(=CC(=N3)C(=O)NC4=NC5=CC=CC=C5C(=C4)OCCN)OCCN)OCCN |
