For research use only. Not for therapeutic Use.
Pyridoxine(CAT: R066834) is a form of vitamin B6, which is an essential nutrient for human health. Pyridoxine is involved in a number of important functions in the body, including the metabolism of amino acids and the synthesis of neurotransmitters such as serotonin, norepinephrine, and dopamine. It also plays a role in the formation of red blood cells and in maintaining the health of the immune system.
| Catalog Number | R066834 |
| CAS Number | 65-23-6 |
| Synonyms | 5-hydroxy-6-methyl-3,4-pyridinedimethanol |
| Molecular Formula | C8H11NO3 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | Room temperature |
| IUPAC Name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol |
| InChI | InChI=1S/C8H11NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5/h2,10-12H,3-4H2,1H3 |
| InChIKey | LXNHXLLTXMVWPM-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C(=C1O)CO)CO |
| Reference | 1.. Vitamin B6 (pyridoxine and pyridoxal 5/’-phosphate). Altern. Med. Rev. 6(1), 87-92 (2001). |
