For research use only. Not for therapeutic Use.
Pyrimethanil-d5（Cat No.:I043647）is a deuterated form of pyrimethanil, a fungicide used in agricultural applications to control various fungal diseases in crops such as grapes and apples. The “d5” designation refers to the incorporation of deuterium (heavy hydrogen) atoms into the molecular structure of pyrimethanil, which is often used in analytical studies to trace the compound’s behavior in biological or environmental systems. Pyrimethanil-d5 is primarily used in research for studying the metabolism, pharmacokinetics, and environmental fate of pyrimethanil, providing a stable isotope-labeled reference for detection and quantification in scientific experiments.
| CAS Number | 2118244-83-8 |
| Synonyms | 4,6-dimethyl-N-(2,3,4,5,6-pentadeuteriophenyl)pyrimidin-2-amine |
| Molecular Formula | C12H8D5N3 |
| Purity | ≥95% |
| IUPAC Name | 4,6-dimethyl-N-(2,3,4,5,6-pentadeuteriophenyl)pyrimidin-2-amine |
| InChI | InChI=1S/C12H13N3/c1-9-8-10(2)14-12(13-9)15-11-6-4-3-5-7-11/h3-8H,1-2H3,(H,13,14,15)/i3D,4D,5D,6D,7D |
| InChIKey | ZLIBICFPKPWGIZ-DKFMXDSJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC2=NC(=CC(=N2)C)C)[2H])[2H] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
