For research use only. Not for therapeutic Use.
Pyrimethanil（Cat No.:R056058）is a broad-spectrum fungicide commonly used in agriculture to control fungal diseases in crops, particularly in fruits such as grapes, apples, and strawberries. It inhibits fungal cell wall synthesis by targeting the enzyme chitin synthase. Pyrimethanil is effective against a variety of pathogens, including Botrytis spp. and other ascomycetes. It is applied as a foliar spray to prevent fungal infections. Its low toxicity to humans and animals, coupled with its effective disease control, makes it a valuable tool in integrated pest management strategies for crop protection.
| Catalog Number | R056058 |
| CAS Number | 53112-28-0 |
| Synonyms | 4,6-Dimethyl-N-phenyl-2-pyrimidinamine; 2-Anilino-4,6-dimethylpyrimidine; Mythos; N-(4,6-Dimethylpyrimidin-2-yl)aniline; Penbotec; Scala; |
| Molecular Formula | C12H13N3 |
| Purity | ≥95% |
| Target | Fungal |
| Storage | -20°C |
| IUPAC Name | 4,6-dimethyl-N-phenylpyrimidin-2-amine |
| InChI | InChI=1S/C12H13N3/c1-9-8-10(2)14-12(13-9)15-11-6-4-3-5-7-11/h3-8H,1-2H3,(H,13,14,15) |
| InChIKey | ZLIBICFPKPWGIZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)NC2=CC=CC=C2)C |
