For research use only. Not for therapeutic Use.
Pyrisoxazole(CAT: I035267) is a broad-spectrum triazole fungicide belonging to the demethylation inhibitor (DMI) class, known for its potent inhibition of sterol 14α-demethylase (CYP51), a key enzyme in fungal ergosterol biosynthesis. By disrupting cell membrane formation, pyrisoxazole effectively controls a wide range of plant pathogenic fungi, particularly Ascomycetes and Basidiomycetes, in crops such as rice, fruits, and vegetables. It exhibits protective, curative, and eradicative activity, making it valuable in integrated pest management strategies. Pyrisoxazole is also used in agrochemical research to study resistance mechanisms and fungicide mode of action.
| CAS Number | 847749-37-5 |
| Synonyms | 5-(4-chlorophenyl)-2,3-dimethyl-3-pyridin-3-yl-1,2-oxazolidine |
| Molecular Formula | C16H17ClN2O |
| Purity | ≥95% |
| IUPAC Name | 5-(4-chlorophenyl)-2,3-dimethyl-3-pyridin-3-yl-1,2-oxazolidine |
| InChI | InChI=1S/C16H17ClN2O/c1-16(13-4-3-9-18-11-13)10-15(20-19(16)2)12-5-7-14(17)8-6-12/h3-9,11,15H,10H2,1-2H3 |
| InChIKey | DHTJFQWHCVTNRY-UHFFFAOYSA-N |
| SMILES | CC1(CC(ON1C)C2=CC=C(C=C2)Cl)C3=CN=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
