For research use only. Not for therapeutic Use.
Pyrogallol is a naturally occurring phenolic compound, commonly found in plants and used in various biochemical applications. It is widely recognized for its antioxidant properties, serving as a reducing agent in chemical reactions. Pyrogallol is employed in the synthesis of dyes, as a photographic developer, and in the production of pharmaceuticals. It also plays a significant role in the study of reactive oxygen species (ROS) and oxidative stress, making it valuable in research on cellular processes and disease mechanisms.
CAS Number | 87-66-1 |
Synonyms | 1,2,3-Benzenetriol; 1,2,3-Trihydroxybenzene; 2,3-Dihydroxyphenol; Pyrogallol Acid 2,6-Dihydroxyphenol; Antioxidant PY; Benzene-1,2,3-triol; C.I. 76515; C.I. Oxidation Base 32; Fouramine Brown AP; Fourrine 85; Fourrine PG; NSC 5035; Pyrogallic Acid; |
Molecular Formula | C6H6O3 |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | benzene-1,2,3-triol |
InChI | InChI=1S/C6H6O3/c7-4-2-1-3-5(8)6(4)9/h1-3,7-9H |
InChIKey | WQGWDDDVZFFDIG-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |