For research use only. Not for therapeutic Use.
Pyrrole-2,3,5-tricarboxylic acid(Cat No.:R047750), is an organic compound consisting of a pyrrole ring with three carboxylic acid (-COOH) groups attached at different positions (2, 3, and 5). This compound has applications in various fields, including pharmaceuticals and organic synthesis. It serves as a valuable building block for the creation of complex organic molecules, particularly those with biological activity. Pyrrole-2,3,5-tricarboxylic acid’s versatile structure makes it important in drug discovery and development, as it can be modified to target specific biological processes or receptors, potentially leading to the development of novel pharmaceutical compounds.
CAS Number | 945-32-4 |
Synonyms | 1H-Pyrrole-2,3,5-tricarboxylic Acid |
Molecular Formula | C7H5NO6 |
Purity | ≥95% |
Storage | 2-8°C(protect from light) |
IUPAC Name | 1H-pyrrole-2,3,5-tricarboxylic acid |
InChI | InChI=1S/C7H5NO6/c9-5(10)2-1-3(6(11)12)8-4(2)7(13)14/h1,8H,(H,9,10)(H,11,12)(H,13,14) |
InChIKey | UGSAVTSXHXRENH-UHFFFAOYSA-N |
SMILES | C1=C(NC(=C1C(=O)O)C(=O)O)C(=O)O |