For research use only. Not for therapeutic Use.
Pyrrolnitrin(CAT: M069081) is a natural antibiotic derived from the bacterium Pseudomonas pyrrocinia. It exhibits potent antifungal activity and is widely used in agriculture to control fungal pathogens affecting crops. Pyrrolnitrin works by inhibiting fungal respiration, disrupting energy production, and hindering fungal growth. Its broad-spectrum activity against various fungi, including Rhizoctonia and Fusarium species, makes it valuable in protecting crops such as rice, fruits, and vegetables. In addition to its agricultural applications, pyrrolnitrin has been explored for potential use in developing antifungal medications for human and animal infections. Its natural origin and effectiveness contribute to sustainable agricultural practices.
| Catalog Number | M069081 |
| CAS Number | 1018-71-9 |
| Synonyms | 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole |
| Molecular Formula | C10H6Cl2N2O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C10H6Cl2N2O2/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12/h1-5,13H |
| InChIKey | QJBZDBLBQWFTPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])C2=CNC=C2Cl |
